C13H10F17ISi — CID 46242823
[(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-iododec-1-enyl]-trimethylsilane (PubChem CID 46242823) has the molecular formula C13H10F17ISi and a molecular weight of 644.18 g/mol. Its IUPAC name is [(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-iododec-1-enyl]-trimethylsilane.
| Compound Name | [(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-iododec-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 46242823 |
| Molecular Formula | C13H10F17ISi |
| Molecular Weight | 644.18 g/mol |
| Exact Mass | 643.93 |
| IUPAC Name | [(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-iododec-1-enyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F17ISi/c1-32(2,3)5(31)4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4H,1-3H3/b5-4- |
| InChIKey | VFPUKPUZJQJPCH-PLNGDYQASA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.18 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|