C9H18F2Si — CID 11019698
[(Z)-1,2-difluorohex-1-enyl]-trimethylsilane (PubChem CID 11019698) has the molecular formula C9H18F2Si and a molecular weight of 192.32 g/mol. Its IUPAC name is [(Z)-1,2-difluorohex-1-enyl]-trimethylsilane.
| Compound Name | [(Z)-1,2-difluorohex-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 11019698 |
| Molecular Formula | C9H18F2Si |
| Molecular Weight | 192.32 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | [(Z)-1,2-difluorohex-1-enyl]-trimethylsilane |
| SMILES | CCCC/C(F)=C(\F)[Si](C)(C)C |
| InChI | InChI=1S/C9H18F2Si/c1-5-6-7-8(10)9(11)12(2,3)4/h5-7H2,1-4H3/b9-8- |
| InChIKey | RUXHTVDYDPDKNV-HJWRWDBZSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|