C12H20OSi — CID 101077407
[(3aS)-3,3a,6,7-tetrahydro-1H-cyclohepta[c]furan-8-yl]-trimethylsilane (PubChem CID 101077407) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is [(3aS)-3,3a,6,7-tetrahydro-1H-cyclohepta[c]furan-8-yl]-trimethylsilane.
| Compound Name | [(3aS)-3,3a,6,7-tetrahydro-1H-cyclohepta[c]furan-8-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101077407 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | [(3aS)-3,3a,6,7-tetrahydro-1H-cyclohepta[c]furan-8-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=C2COC[C@H]2C=CCC1 |
| InChI | InChI=1S/C12H20OSi/c1-14(2,3)12-7-5-4-6-10-8-13-9-11(10)12/h4,6,10H,5,7-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | BLOJTVWGYPTYFJ-SNVBAGLBSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|