C38H52AlN2O4P — CID 101079258
aluminum;2,4-ditert-butyl-6-[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;dioxido(phenyl)phosphanium (PubChem CID 101079258) has the molecular formula C38H52AlN2O4P and a molecular weight of 658.80 g/mol. Its IUPAC name is aluminum;2,4-ditert-butyl-6-[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;dioxido(phenyl)phosphanium.
| Compound Name | aluminum;2,4-ditert-butyl-6-[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;dioxido(phenyl)phosphanium |
|---|---|
| PubChem CID | 101079258 |
| Molecular Formula | C38H52AlN2O4P |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | aluminum;2,4-ditert-butyl-6-[2-[(3,5-ditert-butyl-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;dioxido(phenyl)phosphanium |
| SMILES | CC(C)(C)c1cc(/C=N\CC/N=C/c2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.[Al+3].[O-][PH+]([O-])c1ccccc1 |
| InChI | InChI=1S/C32H48N2O2.C6H6O2P.Al/c1-29(2,3)23-15-21(27(35)25(17-23)31(7,8)9)19-33-13-14-34-20-22-16-24(30(4,5)6)18-26(28(22)36)32(10,11)12;7-9(8)6-4-2-1-3-5-6;/h15-20,35-36H,13-14H2,1-12H3;1-5,9H;/q;-1;+3/p-2/b33-19-,34-20+;; |
| InChIKey | UVOSYMDGACMNOO-XQOKUIPOSA-L |
| XLogP | 5.26 |
| TPSA | 116.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|