About (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde
(3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde (PubChem CID 101082408) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde |
| PubChem CID | 101082408 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde |
| SMILES | COC1=CC(=O)[C@]2(CO2)C(C=O)=C1 |
| InChI | InChI=1S/C9H8O4/c1-12-7-2-6(4-10)9(5-13-9)8(11)3-7/h2-4H,5H2,1H3/t9-/m0/s1 |
| InChIKey | PIMFYXCHMRIWRD-VIFPVBQESA-N |
| XLogP | -0.01 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The IUPAC name of (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde (CID 101082408) is (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde.
What is the SMILES notation for (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The canonical SMILES for (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde is COC1=CC(=O)[C@]2(CO2)C(C=O)=C1.
What is the InChIKey of (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The InChIKey is PIMFYXCHMRIWRD-VIFPVBQESA-N. The full InChI is InChI=1S/C9H8O4/c1-12-7-2-6(4-10)9(5-13-9)8(11)3-7/h2-4H,5H2,1H3/t9-/m0/s1.
What are the key properties of (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
(3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde has a molecular weight of 180.16 g/mol, XLogP of -0.01, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-methoxy-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde is sourced from PubChem (CID 101082408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).