About (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde
(3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde (PubChem CID 131169372) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde |
| PubChem CID | 131169372 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde |
| SMILES | COC1=CC(=O)[C@@]2(OC2C)C(C=O)=C1 |
| InChI | InChI=1S/C10H10O4/c1-6-10(14-6)7(5-11)3-8(13-2)4-9(10)12/h3-6H,1-2H3/t6?,10-/m0/s1 |
| InChIKey | ORWGIHAKBYDYCC-TYICEKJOSA-N |
| XLogP | 0.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The IUPAC name of (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde (CID 131169372) is (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde.
What is the SMILES notation for (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The canonical SMILES for (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde is COC1=CC(=O)[C@@]2(OC2C)C(C=O)=C1.
What is the InChIKey of (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
The InChIKey is ORWGIHAKBYDYCC-TYICEKJOSA-N. The full InChI is InChI=1S/C10H10O4/c1-6-10(14-6)7(5-11)3-8(13-2)4-9(10)12/h3-6H,1-2H3/t6?,10-/m0/s1.
What are the key properties of (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde?
(3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde has a molecular weight of 194.19 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-methoxy-2-methyl-4-oxo-1-oxaspiro[2.5]octa-5,7-diene-8-carbaldehyde is sourced from PubChem (CID 131169372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).