C14H15NO2 — CID 101082493
(4S)-3-(2-phenylethynyl)-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101082493) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (4S)-3-(2-phenylethynyl)-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-(2-phenylethynyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101082493 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (4S)-3-(2-phenylethynyl)-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@H]1COC(=O)N1C#Cc1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-11(2)13-10-17-14(16)15(13)9-8-12-6-4-3-5-7-12/h3-7,11,13H,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | BYBHPGLZXRGRGU-CYBMUJFWSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|