About CID 101083027
CID 101083027 (PubChem CID 101083027) has the molecular formula C15H9N2
and a molecular weight of 217.25 g/mol.
Molecular Properties
| Compound Name | CID 101083027 |
| PubChem CID | 101083027 |
| Molecular Formula | C15H9N2 |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | — |
| SMILES | [N]=C=c1ccc(=Cc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C15H9N2/c16-10-14-5-1-12(2-6-14)9-13-3-7-15(11-17)8-4-13/h1-9H |
| InChIKey | VSXOCPXMHGZXRY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 101083027 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101083027?
The IUPAC name of CID 101083027 (CID 101083027) is not available.
What is the SMILES notation for CID 101083027?
The canonical SMILES for CID 101083027 is [N]=C=c1ccc(=Cc2ccc(C#N)cc2)cc1.
What is the InChIKey of CID 101083027?
The InChIKey is VSXOCPXMHGZXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N2/c16-10-14-5-1-12(2-6-14)9-13-3-7-15(11-17)8-4-13/h1-9H.
What are the key properties of CID 101083027?
CID 101083027 has a molecular weight of 217.25 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101083027 is sourced from PubChem (CID 101083027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).