C23H42O4Si2 — CID 101083263
(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 101083263) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 101083263 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-methylbut-2-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)=C[C@@H](O[Si](C)(C)C(C)(C)C)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C23H42O4Si2/c1-15(2)13-17(26-28(9,10)22(3,4)5)16-14-18(20-21(25-20)19(16)24)27-29(11,12)23(6,7)8/h13-14,17-18,20-21H,1-12H3/t17-,18-,20+,21-/m1/s1 |
| InChIKey | WTQBOPJAFVMMGZ-RMVXJAJNSA-N |
| XLogP | 6.01 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|