C19H35BrO4Si2 — CID 11248250
(1R,5S,6S)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11248250) has the molecular formula C19H35BrO4Si2 and a molecular weight of 463.56 g/mol. Its IUPAC name is (1R,5S,6S)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5S,6S)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11248250 |
| Molecular Formula | C19H35BrO4Si2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | (1R,5S,6S)-3-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(Br)C(=O)[C@@H]2O[C@@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35BrO4Si2/c1-18(2,3)25(7,8)22-11-12-13(20)14(21)16-17(23-16)15(12)24-26(9,10)19(4,5)6/h15-17H,11H2,1-10H3/t15-,16-,17+/m0/s1 |
| InChIKey | ACTGPCZTLBLLIJ-YESZJQIVSA-N |
| XLogP | 5.40 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|