C13H21BrO4Si — CID 101368828
(1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 101368828) has the molecular formula C13H21BrO4Si and a molecular weight of 349.30 g/mol. Its IUPAC name is (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 101368828 |
| Molecular Formula | C13H21BrO4Si |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(Br)C(=O)[C@@H]2O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C13H21BrO4Si/c1-13(2,3)19(4,5)17-6-7-8(14)10(16)12-11(18-12)9(7)15/h9,11-12,15H,6H2,1-5H3/t9-,11-,12+/m1/s1 |
| InChIKey | KARWMILKBFDOKT-JLLWLGSASA-N |
| XLogP | 2.37 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|