C14H23BrO4Si — CID 15605973
(1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-6-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 15605973) has the molecular formula C14H23BrO4Si and a molecular weight of 363.32 g/mol. Its IUPAC name is (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-6-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-6-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 15605973 |
| Molecular Formula | C14H23BrO4Si |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (1R,5R,6R)-3-bromo-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-6-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(Br)C(=O)[C@@H]2O[C@]2(C)[C@@H]1O |
| InChI | InChI=1S/C14H23BrO4Si/c1-13(2,3)20(5,6)18-7-8-9(15)10(16)12-14(4,19-12)11(8)17/h11-12,17H,7H2,1-6H3/t11-,12+,14-/m1/s1 |
| InChIKey | OHPNXLVQNLNSIJ-MBNYWOFBSA-N |
| XLogP | 2.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|