C19H36O4Si2 — CID 102212631
(1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 102212631) has the molecular formula C19H36O4Si2 and a molecular weight of 384.67 g/mol. Its IUPAC name is (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 102212631 |
| Molecular Formula | C19H36O4Si2 |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC(=O)[C@H]2O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si2/c1-18(2,3)24(7,8)21-12-13-11-14(20)16-17(22-16)15(13)23-25(9,10)19(4,5)6/h11,15-17H,12H2,1-10H3/t15-,16-,17+/m1/s1 |
| InChIKey | UWUWJAZTCQUTKR-ZACQAIPSSA-N |
| XLogP | 4.68 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|