C19H20OSi — CID 10108408
7,11-dihydronaphtho[2,1-f][1]benzofuran-8-yl(trimethyl)silane (PubChem CID 10108408) has the molecular formula C19H20OSi and a molecular weight of 292.45 g/mol. Its IUPAC name is 7,11-dihydronaphtho[2,1-f][1]benzofuran-8-yl(trimethyl)silane.
| Compound Name | 7,11-dihydronaphtho[2,1-f][1]benzofuran-8-yl(trimethyl)silane |
|---|---|
| PubChem CID | 10108408 |
| Molecular Formula | C19H20OSi |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 7,11-dihydronaphtho[2,1-f][1]benzofuran-8-yl(trimethyl)silane |
| SMILES | C[Si](C)(C)c1coc2c1Cc1ccc3ccccc3c1C2 |
| InChI | InChI=1S/C19H20OSi/c1-21(2,3)19-12-20-18-11-16-14(10-17(18)19)9-8-13-6-4-5-7-15(13)16/h4-9,12H,10-11H2,1-3H3 |
| InChIKey | YRHZWYROTPXYJF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|