About 12H-benzo[a]xanthene;hydrate
12H-benzo[a]xanthene;hydrate (PubChem CID 174249358) has the molecular formula C17H14O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 12H-benzo[a]xanthene;hydrate.
Molecular Properties
| Compound Name | 12H-benzo[a]xanthene;hydrate |
| PubChem CID | 174249358 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 12H-benzo[a]xanthene;hydrate |
| SMILES | O.c1ccc2c(c1)Cc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C17H12O.H2O/c1-3-7-14-12(5-1)9-10-17-15(14)11-13-6-2-4-8-16(13)18-17;/h1-10H,11H2;1H2 |
| InChIKey | FWDDJJHIRUEQEO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 12H-benzo[a]xanthene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12H-benzo[a]xanthene;hydrate?
The IUPAC name of 12H-benzo[a]xanthene;hydrate (CID 174249358) is 12H-benzo[a]xanthene;hydrate.
What is the SMILES notation for 12H-benzo[a]xanthene;hydrate?
The canonical SMILES for 12H-benzo[a]xanthene;hydrate is O.c1ccc2c(c1)Cc1c(ccc3ccccc13)O2.
What is the InChIKey of 12H-benzo[a]xanthene;hydrate?
The InChIKey is FWDDJJHIRUEQEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O.H2O/c1-3-7-14-12(5-1)9-10-17-15(14)11-13-6-2-4-8-16(13)18-17;/h1-10H,11H2;1H2.
What are the key properties of 12H-benzo[a]xanthene;hydrate?
12H-benzo[a]xanthene;hydrate has a molecular weight of 250.30 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12H-benzo[a]xanthene;hydrate is sourced from PubChem (CID 174249358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).