About 9H-xanthen-1-amine;hydrochloride
9H-xanthen-1-amine;hydrochloride (PubChem CID 175135192) has the molecular formula C13H12ClNO
and a molecular weight of 233.70 g/mol. Its IUPAC name is 9H-xanthen-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 9H-xanthen-1-amine;hydrochloride |
| PubChem CID | 175135192 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 9H-xanthen-1-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2c1Cc1ccccc1O2 |
| InChI | InChI=1S/C13H11NO.ClH/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;/h1-7H,8,14H2;1H |
| InChIKey | ZPVFBFAPXZHOLU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-xanthen-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthen-1-amine;hydrochloride?
The IUPAC name of 9H-xanthen-1-amine;hydrochloride (CID 175135192) is 9H-xanthen-1-amine;hydrochloride.
What is the SMILES notation for 9H-xanthen-1-amine;hydrochloride?
The canonical SMILES for 9H-xanthen-1-amine;hydrochloride is Cl.Nc1cccc2c1Cc1ccccc1O2.
What is the InChIKey of 9H-xanthen-1-amine;hydrochloride?
The InChIKey is ZPVFBFAPXZHOLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.ClH/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13;/h1-7H,8,14H2;1H.
What are the key properties of 9H-xanthen-1-amine;hydrochloride?
9H-xanthen-1-amine;hydrochloride has a molecular weight of 233.70 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthen-1-amine;hydrochloride is sourced from PubChem (CID 175135192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).