C21H32N6O4S2 — CID 101084103
3-[5-[3-(2-imidazol-1-ylethylamino)-3-oxopropoxy]dithian-4-yl]oxy-N-(3-imidazol-1-ylpropyl)propanamide (PubChem CID 101084103) has the molecular formula C21H32N6O4S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 3-[5-[3-(2-imidazol-1-ylethylamino)-3-oxopropoxy]dithian-4-yl]oxy-N-(3-imidazol-1-ylpropyl)propanamide.
| Compound Name | 3-[5-[3-(2-imidazol-1-ylethylamino)-3-oxopropoxy]dithian-4-yl]oxy-N-(3-imidazol-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 101084103 |
| Molecular Formula | C21H32N6O4S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-[5-[3-(2-imidazol-1-ylethylamino)-3-oxopropoxy]dithian-4-yl]oxy-N-(3-imidazol-1-ylpropyl)propanamide |
| SMILES | O=C(CCOC1CSSCC1OCCC(=O)NCCn1ccnc1)NCCCn1ccnc1 |
| InChI | InChI=1S/C21H32N6O4S2/c28-20(24-4-1-8-26-9-5-22-16-26)2-12-30-18-14-32-33-15-19(18)31-13-3-21(29)25-7-11-27-10-6-23-17-27/h5-6,9-10,16-19H,1-4,7-8,11-15H2,(H,24,28)(H,25,29) |
| InChIKey | ABRWSZLBPIGFHY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|