C10H11Br3O4 — CID 101084589
[(1R,2R,5R,6S)-6-acetyloxy-2,4,5-tribromocyclohex-3-en-1-yl] acetate (PubChem CID 101084589) has the molecular formula C10H11Br3O4 and a molecular weight of 434.91 g/mol. Its IUPAC name is [(1R,2R,5R,6S)-6-acetyloxy-2,4,5-tribromocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2R,5R,6S)-6-acetyloxy-2,4,5-tribromocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 101084589 |
| Molecular Formula | C10H11Br3O4 |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 431.82 |
| IUPAC Name | [(1R,2R,5R,6S)-6-acetyloxy-2,4,5-tribromocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](Br)C(Br)=C[C@H]1Br |
| InChI | InChI=1S/C10H11Br3O4/c1-4(14)16-9-7(12)3-6(11)8(13)10(9)17-5(2)15/h3,7-10H,1-2H3/t7-,8+,9+,10-/m1/s1 |
| InChIKey | TZDLNBDUKMSNDK-XFWSIPNHSA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|