C11H13Br2IO4 — CID 11641764
[(1S,2R,5S,6S)-6-acetyloxy-2,5-dibromo-3-iodo-6-methylcyclohex-3-en-1-yl] acetate (PubChem CID 11641764) has the molecular formula C11H13Br2IO4 and a molecular weight of 495.93 g/mol. Its IUPAC name is [(1S,2R,5S,6S)-6-acetyloxy-2,5-dibromo-3-iodo-6-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2R,5S,6S)-6-acetyloxy-2,5-dibromo-3-iodo-6-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 11641764 |
| Molecular Formula | C11H13Br2IO4 |
| Molecular Weight | 495.93 g/mol |
| Exact Mass | 493.82 |
| IUPAC Name | [(1S,2R,5S,6S)-6-acetyloxy-2,5-dibromo-3-iodo-6-methylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](Br)C(I)=C[C@H](Br)[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C11H13Br2IO4/c1-5(15)17-10-9(13)7(14)4-8(12)11(10,3)18-6(2)16/h4,8-10H,1-3H3/t8-,9-,10+,11+/m0/s1 |
| InChIKey | PZKIZKAZOGXOJF-UKKRHICBSA-N |
| XLogP | 3.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|