C10H11Br2IO4 — CID 11155911
[(1S,2S,5R,6S)-6-acetyloxy-2,5-dibromo-4-iodocyclohex-3-en-1-yl] acetate (PubChem CID 11155911) has the molecular formula C10H11Br2IO4 and a molecular weight of 481.91 g/mol. Its IUPAC name is [(1S,2S,5R,6S)-6-acetyloxy-2,5-dibromo-4-iodocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,5R,6S)-6-acetyloxy-2,5-dibromo-4-iodocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 11155911 |
| Molecular Formula | C10H11Br2IO4 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 479.81 |
| IUPAC Name | [(1S,2S,5R,6S)-6-acetyloxy-2,5-dibromo-4-iodocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](Br)C(I)=C[C@@H]1Br |
| InChI | InChI=1S/C10H11Br2IO4/c1-4(14)16-9-6(11)3-7(13)8(12)10(9)17-5(2)15/h3,6,8-10H,1-2H3/t6-,8-,9+,10+/m0/s1 |
| InChIKey | DIUWDOSBYMOFKL-BEYHFKMWSA-N |
| XLogP | 2.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|