C11H14Br2O4 — CID 16749593
[(1S,2S,5R,6R)-6-acetyloxy-2,5-dibromo-6-methylcyclohex-3-en-1-yl] acetate (PubChem CID 16749593) has the molecular formula C11H14Br2O4 and a molecular weight of 370.04 g/mol. Its IUPAC name is [(1S,2S,5R,6R)-6-acetyloxy-2,5-dibromo-6-methylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,5R,6R)-6-acetyloxy-2,5-dibromo-6-methylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 16749593 |
| Molecular Formula | C11H14Br2O4 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.93 |
| IUPAC Name | [(1S,2S,5R,6R)-6-acetyloxy-2,5-dibromo-6-methylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](Br)C=C[C@@H](Br)[C@]1(C)OC(C)=O |
| InChI | InChI=1S/C11H14Br2O4/c1-6(14)16-10-8(12)4-5-9(13)11(10,3)17-7(2)15/h4-5,8-10H,1-3H3/t8-,9+,10+,11-/m0/s1 |
| InChIKey | RNHQOFYMDBVBLP-ZDCRXTMVSA-N |
| XLogP | 2.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|