C14H18O2 — CID 101085406
(3aS,6aR,9aR,9bS)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 101085406) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (3aS,6aR,9aR,9bS)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3aS,6aR,9aR,9bS)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 101085406 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3aS,6aR,9aR,9bS)-6-methyl-9-methylidene-3,3a,4,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(C)=CC[C@H]3CC(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C14H18O2/c1-8-3-5-10-7-12(15)16-14(10)13-9(2)4-6-11(8)13/h3,10-11,13-14H,2,4-7H2,1H3/t10-,11-,13-,14-/m0/s1 |
| InChIKey | VPWQENIBTDMLKS-IMIFBBOLSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|