C21H21ClO2 — CID 72546455
(3Z,3aS,6aR,9aR,9bS)-3-[(4-chlorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 72546455) has the molecular formula C21H21ClO2 and a molecular weight of 340.85 g/mol. Its IUPAC name is (3Z,3aS,6aR,9aR,9bS)-3-[(4-chlorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3Z,3aS,6aR,9aR,9bS)-3-[(4-chlorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 72546455 |
| Molecular Formula | C21H21ClO2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | (3Z,3aS,6aR,9aR,9bS)-3-[(4-chlorophenyl)methylidene]-6,9-dimethylidene-3a,4,5,6a,7,8,9a,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2C(=C)CC[C@H]3/C(=C/c4ccc(Cl)cc4)C(=O)O[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C21H21ClO2/c1-12-3-10-17-18(11-14-5-7-15(22)8-6-14)21(23)24-20(17)19-13(2)4-9-16(12)19/h5-8,11,16-17,19-20H,1-4,9-10H2/b18-11-/t16-,17-,19-,20-/m0/s1 |
| InChIKey | DOUKOOOJWZXHRI-JRVSZXKWSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|