C15H20O4 — CID 101356936
(1R,2S,5S,6S,10R,14R)-5,14-dimethyl-9-methylidene-3,13-dioxatricyclo[8.4.0.02,6]tetradecane-4,12-dione (PubChem CID 101356936) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,2S,5S,6S,10R,14R)-5,14-dimethyl-9-methylidene-3,13-dioxatricyclo[8.4.0.02,6]tetradecane-4,12-dione.
| Compound Name | (1R,2S,5S,6S,10R,14R)-5,14-dimethyl-9-methylidene-3,13-dioxatricyclo[8.4.0.02,6]tetradecane-4,12-dione |
|---|---|
| PubChem CID | 101356936 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1R,2S,5S,6S,10R,14R)-5,14-dimethyl-9-methylidene-3,13-dioxatricyclo[8.4.0.02,6]tetradecane-4,12-dione |
| SMILES | C=C1CC[C@@H]2[C@H](OC(=O)[C@H]2C)[C@H]2[C@@H](C)OC(=O)C[C@@H]12 |
| InChI | InChI=1S/C15H20O4/c1-7-4-5-10-8(2)15(17)19-14(10)13-9(3)18-12(16)6-11(7)13/h8-11,13-14H,1,4-6H2,2-3H3/t8-,9+,10-,11-,13-,14-/m0/s1 |
| InChIKey | MILMMXLPUBIAAD-QFILMLMFSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|