C20H26O4 — CID 163185881
[(3S,3aR,6aR,8S,9aR,9bS)-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 163185881) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is [(3S,3aR,6aR,8S,9aR,9bS)-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3S,3aR,6aR,8S,9aR,9bS)-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163185881 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [(3S,3aR,6aR,8S,9aR,9bS)-3-methyl-6,9-dimethylidene-2-oxo-3a,4,5,6a,7,8,9a,9b-octahydro-3H-azuleno[4,5-b]furan-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1[C@@H]2[C@H]3OC(=O)[C@@H](C)[C@H]3CCC(=C)[C@@H]2C[C@@H]1OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C20H26O4/c1-6-10(2)19(21)23-16-9-15-11(3)7-8-14-12(4)20(22)24-18(14)17(15)13(16)5/h6,12,14-18H,3,5,7-9H2,1-2,4H3/b10-6-/t12-,14+,15-,16-,17-,18-/m0/s1 |
| InChIKey | XLTXCDCBPIIWRO-LFXSTBPXSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|