C20H26O6 — CID 45359674
(5,9-dimethyl-4-oxospiro[3,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-14,2'-oxirane]-10-yl) (Z)-2-methylbut-2-enoate (PubChem CID 45359674) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (5,9-dimethyl-4-oxospiro[3,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-14,2'-oxirane]-10-yl) (Z)-2-methylbut-2-enoate.
| Compound Name | (5,9-dimethyl-4-oxospiro[3,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-14,2'-oxirane]-10-yl) (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 45359674 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (5,9-dimethyl-4-oxospiro[3,12-dioxatetracyclo[7.5.0.02,6.011,13]tetradecane-14,2'-oxirane]-10-yl) (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1C2OC2C2(CO2)C2C3OC(=O)C(C)C3CCC12C |
| InChI | InChI=1S/C20H26O6/c1-5-9(2)17(21)26-15-13-16(24-13)20(8-23-20)14-12-11(6-7-19(14,15)4)10(3)18(22)25-12/h5,10-16H,6-8H2,1-4H3/b9-5- |
| InChIKey | SZSNPNCTSHASFJ-UITAMQMPSA-N |
| XLogP | 2.01 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|