C15H20O4 — CID 162816865
(3S,3aS,7R,10Z,11aS)-7-hydroxy-3,10-dimethyl-6-methylidene-3a,4,5,7,8,11a-hexahydro-3H-cyclodeca[b]furan-2,9-dione (PubChem CID 162816865) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (3S,3aS,7R,10Z,11aS)-7-hydroxy-3,10-dimethyl-6-methylidene-3a,4,5,7,8,11a-hexahydro-3H-cyclodeca[b]furan-2,9-dione.
| Compound Name | (3S,3aS,7R,10Z,11aS)-7-hydroxy-3,10-dimethyl-6-methylidene-3a,4,5,7,8,11a-hexahydro-3H-cyclodeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 162816865 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (3S,3aS,7R,10Z,11aS)-7-hydroxy-3,10-dimethyl-6-methylidene-3a,4,5,7,8,11a-hexahydro-3H-cyclodeca[b]furan-2,9-dione |
| SMILES | C=C1CC[C@H]2[C@H](C)C(=O)O[C@@H]2/C=C(/C)C(=O)C[C@H]1O |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-11-10(3)15(18)19-14(11)6-9(2)13(17)7-12(8)16/h6,10-12,14,16H,1,4-5,7H2,2-3H3/b9-6-/t10-,11-,12+,14+/m0/s1 |
| InChIKey | ZSWCIGXOGJAYMQ-PNDYUTCWSA-N |
| XLogP | 1.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|