C15H20O3 — CID 10422126
(3S,3aS,6aS,8S,9bS)-8-hydroxy-3,9-dimethyl-6-methylidene-3,3a,4,5,6a,7,8,9b-octahydroazuleno[4,5-b]furan-2-one (PubChem CID 10422126) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (3S,3aS,6aS,8S,9bS)-8-hydroxy-3,9-dimethyl-6-methylidene-3,3a,4,5,6a,7,8,9b-octahydroazuleno[4,5-b]furan-2-one.
| Compound Name | (3S,3aS,6aS,8S,9bS)-8-hydroxy-3,9-dimethyl-6-methylidene-3,3a,4,5,6a,7,8,9b-octahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 10422126 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (3S,3aS,6aS,8S,9bS)-8-hydroxy-3,9-dimethyl-6-methylidene-3,3a,4,5,6a,7,8,9b-octahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC[C@H]2[C@H](C)C(=O)O[C@@H]2C2=C(C)[C@@H](O)C[C@@H]12 |
| InChI | InChI=1S/C15H20O3/c1-7-4-5-10-8(2)15(17)18-14(10)13-9(3)12(16)6-11(7)13/h8,10-12,14,16H,1,4-6H2,2-3H3/t8-,10-,11-,12-,14-/m0/s1 |
| InChIKey | JBQQYYLITLAINH-QMPJVZAXSA-N |
| XLogP | 2.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|