C24H22O4 — CID 101086226
8'-[(E)-but-2-enoxy]spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-5,6,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 101086226) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 8'-[(E)-but-2-enoxy]spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-5,6,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | 8'-[(E)-but-2-enoxy]spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-5,6,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 101086226 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 8'-[(E)-but-2-enoxy]spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-5,6,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | C/C=C/COC1CCCC2=C1C(=O)C=CC21Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C24H22O4/c1-2-3-15-26-19-10-6-9-17-23(19)18(25)13-14-24(17)27-20-11-4-7-16-8-5-12-21(28-24)22(16)20/h2-5,7-8,11-14,19H,6,9-10,15H2,1H3/b3-2+ |
| InChIKey | BZIVLGQLZLAPNF-NSCUHMNNSA-N |
| XLogP | 4.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|