C20H14O4 — CID 11186201
spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,5'-3,4-dihydro-2H-naphthalene]-1',8'-dione (PubChem CID 11186201) has the molecular formula C20H14O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,5'-3,4-dihydro-2H-naphthalene]-1',8'-dione.
| Compound Name | spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,5'-3,4-dihydro-2H-naphthalene]-1',8'-dione |
|---|---|
| PubChem CID | 11186201 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | spiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,5'-3,4-dihydro-2H-naphthalene]-1',8'-dione |
| SMILES | O=C1C=CC2(Oc3cccc4cccc(c34)O2)C2=C1C(=O)CCC2 |
| InChI | InChI=1S/C20H14O4/c21-14-7-3-6-13-19(14)15(22)10-11-20(13)23-16-8-1-4-12-5-2-9-17(24-20)18(12)16/h1-2,4-5,8-11H,3,6-7H2 |
| InChIKey | MULJGIPMHSPAJG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|