C23H16O5 — CID 132937020
CID 132937020 (PubChem CID 132937020) has the molecular formula C23H16O5 and a molecular weight of 372.38 g/mol.
| Compound Name | CID 132937020 |
|---|---|
| PubChem CID | 132937020 |
| Molecular Formula | C23H16O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | — |
| SMILES | O=C1CCC(=O)C12C(O)c1ccccc1C21Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C23H16O5/c24-18-11-12-19(25)22(18)21(26)14-7-1-2-8-15(14)23(22)27-16-9-3-5-13-6-4-10-17(28-23)20(13)16/h1-10,21,26H,11-12H2 |
| InChIKey | NYJFRTIDCTWEKB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|