C20H18O7 — CID 85170753
4',6',7',8'a-tetrahydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-one (PubChem CID 85170753) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is 4',6',7',8'a-tetrahydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-one.
| Compound Name | 4',6',7',8'a-tetrahydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 85170753 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4',6',7',8'a-tetrahydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,8'-3,4,6,7-tetrahydro-2H-naphthalene]-1'-one |
| SMILES | O=C1CCC(O)C2=CC(O)C(O)C3(Oc4cccc5cccc(c45)O3)C12O |
| InChI | InChI=1S/C20H18O7/c21-12-7-8-16(23)19(25)11(12)9-13(22)18(24)20(19)26-14-5-1-3-10-4-2-6-15(27-20)17(10)14/h1-6,9,12-13,18,21-22,24-25H,7-8H2 |
| InChIKey | IETBVXMUDJHZAJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|