C21H14O8 — CID 162920945
(1'S,2'S,3'S,5'S,7'R)-2'-hydroxy-2'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8',11'-dione (PubChem CID 162920945) has the molecular formula C21H14O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is (1'S,2'S,3'S,5'S,7'R)-2'-hydroxy-2'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8',11'-dione.
| Compound Name | (1'S,2'S,3'S,5'S,7'R)-2'-hydroxy-2'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8',11'-dione |
|---|---|
| PubChem CID | 162920945 |
| Molecular Formula | C21H14O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (1'S,2'S,3'S,5'S,7'R)-2'-hydroxy-2'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodec-9-ene]-8',11'-dione |
| SMILES | CO[C@@]1(O)[C@H]2O[C@@H]2C2(Oc3cccc4cccc(c34)O2)[C@@]23O[C@@]12C(=O)C=CC3=O |
| InChI | InChI=1S/C21H14O8/c1-25-20(24)16-17(26-16)21(19-14(23)9-8-13(22)18(19,20)29-19)27-11-6-2-4-10-5-3-7-12(28-21)15(10)11/h2-9,16-17,24H,1H3/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | MYXNJIZFJSNFMA-KNJMJIDISA-N |
| XLogP | 0.64 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|