C21H18O4 — CID 53355962
(4'aR,8'S,8'aR)-8'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-4a,7,8,8a-tetrahydronaphthalene]-1'-one (PubChem CID 53355962) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (4'aR,8'S,8'aR)-8'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-4a,7,8,8a-tetrahydronaphthalene]-1'-one.
| Compound Name | (4'aR,8'S,8'aR)-8'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-4a,7,8,8a-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 53355962 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (4'aR,8'S,8'aR)-8'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,4'-4a,7,8,8a-tetrahydronaphthalene]-1'-one |
| SMILES | CO[C@H]1CC=C[C@@H]2[C@H]1C(=O)C=CC21Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C21H18O4/c1-23-16-8-4-7-14-20(16)15(22)11-12-21(14)24-17-9-2-5-13-6-3-10-18(25-21)19(13)17/h2-7,9-12,14,16,20H,8H2,1H3/t14-,16+,20+/m1/s1 |
| InChIKey | KAACIEBDNNYLHG-IIMJZQEZSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|