C22H16O6 — CID 102008797
1'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-9-oxatricyclo[6.2.2.02,7]dodeca-4,11-diene]-3',10'-dione (PubChem CID 102008797) has the molecular formula C22H16O6 and a molecular weight of 376.36 g/mol. Its IUPAC name is 1'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-9-oxatricyclo[6.2.2.02,7]dodeca-4,11-diene]-3',10'-dione.
| Compound Name | 1'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-9-oxatricyclo[6.2.2.02,7]dodeca-4,11-diene]-3',10'-dione |
|---|---|
| PubChem CID | 102008797 |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1'-methoxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-9-oxatricyclo[6.2.2.02,7]dodeca-4,11-diene]-3',10'-dione |
| SMILES | COC12C=CC(OC1=O)C1C2C(=O)C=CC12Oc1cccc3cccc(c13)O2 |
| InChI | InChI=1S/C22H16O6/c1-25-21-10-9-16(26-20(21)24)19-18(21)13(23)8-11-22(19)27-14-6-2-4-12-5-3-7-15(28-22)17(12)14/h2-11,16,18-19H,1H3 |
| InChIKey | WIWCCXAMDNMKNO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|