C26H26O8 — CID 74111077
(4,8-diacetyloxyspiro[2,3,4,4a,8,8a-hexahydro-1H-naphthalene-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-yl) acetate (PubChem CID 74111077) has the molecular formula C26H26O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is (4,8-diacetyloxyspiro[2,3,4,4a,8,8a-hexahydro-1H-naphthalene-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-yl) acetate.
| Compound Name | (4,8-diacetyloxyspiro[2,3,4,4a,8,8a-hexahydro-1H-naphthalene-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-yl) acetate |
|---|---|
| PubChem CID | 74111077 |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (4,8-diacetyloxyspiro[2,3,4,4a,8,8a-hexahydro-1H-naphthalene-5,3'-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene]-1-yl) acetate |
| SMILES | CC(=O)OC1C=CC2(Oc3cccc4cccc(c34)O2)C2C(OC(C)=O)CCC(OC(C)=O)C12 |
| InChI | InChI=1S/C26H26O8/c1-14(27)30-18-10-11-22(32-16(3)29)25-24(18)19(31-15(2)28)12-13-26(25)33-20-8-4-6-17-7-5-9-21(34-26)23(17)20/h4-9,12-13,18-19,22,24-25H,10-11H2,1-3H3 |
| InChIKey | RCUVSKATLBDJQO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|