C20H14O7 — CID 101077062
(1'S,5'R,7'S,8'R)-8'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodecane]-2',11'-dione (PubChem CID 101077062) has the molecular formula C20H14O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is (1'S,5'R,7'S,8'R)-8'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodecane]-2',11'-dione.
| Compound Name | (1'S,5'R,7'S,8'R)-8'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodecane]-2',11'-dione |
|---|---|
| PubChem CID | 101077062 |
| Molecular Formula | C20H14O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (1'S,5'R,7'S,8'R)-8'-hydroxyspiro[2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-3,6'-4,12-dioxatetracyclo[5.4.1.01,7.03,5]dodecane]-2',11'-dione |
| SMILES | O=C1CC[C@@H](O)[C@]23O[C@]12C(=O)C1O[C@H]1C31Oc2cccc3cccc(c23)O1 |
| InChI | InChI=1S/C20H14O7/c21-12-7-8-13(22)19-18(12,27-19)16(23)15-17(24-15)20(19)25-10-5-1-3-9-4-2-6-11(26-20)14(9)10/h1-6,13,15,17,22H,7-8H2/t13-,15?,17-,18+,19+/m1/s1 |
| InChIKey | ORBBBKIBWGCZPK-GYISXVGNSA-N |
| XLogP | 0.89 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|