C23H20O7 — CID 11441177
(1R,11R,18S)-6-methoxy-18-(methoxymethoxy)-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,9,13,15,17(22)-heptaen-8-one (PubChem CID 11441177) has the molecular formula C23H20O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is (1R,11R,18S)-6-methoxy-18-(methoxymethoxy)-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,9,13,15,17(22)-heptaen-8-one.
| Compound Name | (1R,11R,18S)-6-methoxy-18-(methoxymethoxy)-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,9,13,15,17(22)-heptaen-8-one |
|---|---|
| PubChem CID | 11441177 |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (1R,11R,18S)-6-methoxy-18-(methoxymethoxy)-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,9,13,15,17(22)-heptaen-8-one |
| SMILES | COCO[C@H]1CC[C@]23Oc4ccc(OC)c5c4[C@](C=CC5=O)(Oc4cccc1c42)O3 |
| InChI | InChI=1S/C23H20O7/c1-25-12-27-15-9-11-22-20-13(15)4-3-5-17(20)28-23(30-22)10-8-14(24)19-16(26-2)6-7-18(29-22)21(19)23/h3-8,10,15H,9,11-12H2,1-2H3/t15-,22+,23+/m0/s1 |
| InChIKey | DIGBIHILPRSVLB-WADWEFIESA-N |
| XLogP | 3.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|