C16H16O7 — CID 56657459
3'-(hydroxymethyl)-4-methoxy-3'-(3-methyl-5-oxooxolan-2-yl)spiro[1-benzofuran-2,2'-oxirane]-3-one (PubChem CID 56657459) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 3'-(hydroxymethyl)-4-methoxy-3'-(3-methyl-5-oxooxolan-2-yl)spiro[1-benzofuran-2,2'-oxirane]-3-one.
| Compound Name | 3'-(hydroxymethyl)-4-methoxy-3'-(3-methyl-5-oxooxolan-2-yl)spiro[1-benzofuran-2,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 56657459 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3'-(hydroxymethyl)-4-methoxy-3'-(3-methyl-5-oxooxolan-2-yl)spiro[1-benzofuran-2,2'-oxirane]-3-one |
| SMILES | COc1cccc2c1C(=O)C1(O2)OC1(CO)C1OC(=O)CC1C |
| InChI | InChI=1S/C16H16O7/c1-8-6-11(18)21-14(8)15(7-17)16(23-15)13(19)12-9(20-2)4-3-5-10(12)22-16/h3-5,8,14,17H,6-7H2,1-2H3 |
| InChIKey | NNECITJDSWIVBY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|