C23H20O8 — CID 11464404
(1S,10R,11S,20R)-6,10,20-trimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione (PubChem CID 11464404) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is (1S,10R,11S,20R)-6,10,20-trimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione.
| Compound Name | (1S,10R,11S,20R)-6,10,20-trimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione |
|---|---|
| PubChem CID | 11464404 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (1S,10R,11S,20R)-6,10,20-trimethoxy-2,12,21-trioxahexacyclo[9.9.1.11,13.13,7.011,23.017,22]tricosa-3(23),4,6,13,15,17(22)-hexaene-8,18-dione |
| SMILES | COc1ccc2c3c1C(=O)C[C@@H](OC)[C@]31Oc3cccc4c3[C@](O2)(O1)[C@H](OC)CC4=O |
| InChI | InChI=1S/C23H20O8/c1-26-14-7-8-16-21-19(14)13(25)10-18(28-3)23(21)29-15-6-4-5-11-12(24)9-17(27-2)22(30-16,31-23)20(11)15/h4-8,17-18H,9-10H2,1-3H3/t17-,18-,22-,23-/m1/s1 |
| InChIKey | OASHZCBHCNSJCT-DPZOUVDISA-N |
| XLogP | 2.71 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |