C24H21N3O4 — CID 101086519
methyl (2S)-2-(benzylamino)-3-[1-(3,4-dioxonaphthalen-1-yl)imidazol-4-yl]propanoate (PubChem CID 101086519) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is methyl (2S)-2-(benzylamino)-3-[1-(3,4-dioxonaphthalen-1-yl)imidazol-4-yl]propanoate.
| Compound Name | methyl (2S)-2-(benzylamino)-3-[1-(3,4-dioxonaphthalen-1-yl)imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 101086519 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | methyl (2S)-2-(benzylamino)-3-[1-(3,4-dioxonaphthalen-1-yl)imidazol-4-yl]propanoate |
| SMILES | COC(=O)[C@H](Cc1cn(C2=CC(=O)C(=O)c3ccccc32)cn1)NCc1ccccc1 |
| InChI | InChI=1S/C24H21N3O4/c1-31-24(30)20(25-13-16-7-3-2-4-8-16)11-17-14-27(15-26-17)21-12-22(28)23(29)19-10-6-5-9-18(19)21/h2-10,12,14-15,20,25H,11,13H2,1H3/t20-/m0/s1 |
| InChIKey | VMBFFMXVDSUXDI-FQEVSTJZSA-N |
| XLogP | 2.41 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|