C21H18S — CID 101086551
(Z)-1,3,3-triphenylprop-1-ene-2-thiol (PubChem CID 101086551) has the molecular formula C21H18S and a molecular weight of 302.44 g/mol. Its IUPAC name is (Z)-1,3,3-triphenylprop-1-ene-2-thiol.
| Compound Name | (Z)-1,3,3-triphenylprop-1-ene-2-thiol |
|---|---|
| PubChem CID | 101086551 |
| Molecular Formula | C21H18S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (Z)-1,3,3-triphenylprop-1-ene-2-thiol |
| SMILES | S/C(=C\c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18S/c22-20(16-17-10-4-1-5-11-17)21(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16,21-22H/b20-16- |
| InChIKey | FYHJEQUTISLXHD-SILNSSARSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|