C13H14O4 — CID 101087163
(3R,5R)-5-(1,3-benzodioxol-5-yl)-3,5-dimethyloxolan-2-one (PubChem CID 101087163) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is (3R,5R)-5-(1,3-benzodioxol-5-yl)-3,5-dimethyloxolan-2-one.
| Compound Name | (3R,5R)-5-(1,3-benzodioxol-5-yl)-3,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 101087163 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | (3R,5R)-5-(1,3-benzodioxol-5-yl)-3,5-dimethyloxolan-2-one |
| SMILES | C[C@@H]1C[C@](C)(c2ccc3c(c2)OCO3)OC1=O |
| InChI | InChI=1S/C13H14O4/c1-8-6-13(2,17-12(8)14)9-3-4-10-11(5-9)16-7-15-10/h3-5,8H,6-7H2,1-2H3/t8-,13-/m1/s1 |
| InChIKey | LQODQDZSEIXMPH-AMIZOPFISA-N |
| XLogP | 2.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |