C20H18O6 — CID 85383029
5-[1-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-1,3-benzodioxole (PubChem CID 85383029) has the molecular formula C20H18O6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-1,3-benzodioxole.
| Compound Name | 5-[1-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 85383029 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-yl)-4,5-dimethyl-2,6-dioxabicyclo[3.1.0]hexan-3-yl]-1,3-benzodioxole |
| SMILES | CC1C(c2ccc3c(c2)OCO3)OC2(c3ccc4c(c3)OCO4)OC12C |
| InChI | InChI=1S/C20H18O6/c1-11-18(12-3-5-14-16(7-12)23-9-21-14)25-20(19(11,2)26-20)13-4-6-15-17(8-13)24-10-22-15/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | MSOPBDPJGRPXDR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|