C18H16Cl3NO2 — CID 101087967
1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone (PubChem CID 101087967) has the molecular formula C18H16Cl3NO2 and a molecular weight of 384.69 g/mol. Its IUPAC name is 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone.
| Compound Name | 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone |
|---|---|
| PubChem CID | 101087967 |
| Molecular Formula | C18H16Cl3NO2 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone |
| SMILES | C=CC1C(C(C)=O)=CN(Cc2ccccc2)C=C1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H16Cl3NO2/c1-3-14-15(12(2)23)10-22(9-13-7-5-4-6-8-13)11-16(14)17(24)18(19,20)21/h3-8,10-11,14H,1,9H2,2H3 |
| InChIKey | QEDMNOIIEWKIIO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|