About 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone
1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone (PubChem CID 101087967) has the molecular formula C18H16Cl3NO2
and a molecular weight of 384.69 g/mol. Its IUPAC name is 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone.
Molecular Properties
| Compound Name | 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone |
| PubChem CID | 101087967 |
| Molecular Formula | C18H16Cl3NO2 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone |
| SMILES | C=CC1C(C(C)=O)=CN(Cc2ccccc2)C=C1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H16Cl3NO2/c1-3-14-15(12(2)23)10-22(9-13-7-5-4-6-8-13)11-16(14)17(24)18(19,20)21/h3-8,10-11,14H,1,9H2,2H3 |
| InChIKey | QEDMNOIIEWKIIO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone?
The IUPAC name of 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone (CID 101087967) is 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone.
What is the SMILES notation for 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone?
The canonical SMILES for 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone is C=CC1C(C(C)=O)=CN(Cc2ccccc2)C=C1C(=O)C(Cl)(Cl)Cl.
What is the InChIKey of 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone?
The InChIKey is QEDMNOIIEWKIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl3NO2/c1-3-14-15(12(2)23)10-22(9-13-7-5-4-6-8-13)11-16(14)17(24)18(19,20)21/h3-8,10-11,14H,1,9H2,2H3.
What are the key properties of 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone?
1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone has a molecular weight of 384.69 g/mol, XLogP of 4.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-acetyl-1-benzyl-4-ethenyl-4H-pyridin-3-yl)-2,2,2-trichloroethanone is sourced from PubChem (CID 101087967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).