C19H24O3 — CID 101088381
methyl 4-[(1R,6R)-3-hydroxy-3-tricyclo[4.4.1.01,6]undecanyl]benzoate (PubChem CID 101088381) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is methyl 4-[(1R,6R)-3-hydroxy-3-tricyclo[4.4.1.01,6]undecanyl]benzoate.
| Compound Name | methyl 4-[(1R,6R)-3-hydroxy-3-tricyclo[4.4.1.01,6]undecanyl]benzoate |
|---|---|
| PubChem CID | 101088381 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | methyl 4-[(1R,6R)-3-hydroxy-3-tricyclo[4.4.1.01,6]undecanyl]benzoate |
| SMILES | COC(=O)c1ccc(C2(O)CC[C@@]34CCCC[C@]3(C2)C4)cc1 |
| InChI | InChI=1S/C19H24O3/c1-22-16(20)14-4-6-15(7-5-14)19(21)11-10-17-8-2-3-9-18(17,12-17)13-19/h4-7,21H,2-3,8-13H2,1H3/t17-,18-,19?/m1/s1 |
| InChIKey | MYLYFNWFXUTBFJ-PWCSWUJKSA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |