About (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol
(3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol (PubChem CID 101089327) has the molecular formula C13H18OS
and a molecular weight of 222.35 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol |
| PubChem CID | 101089327 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol |
| SMILES | C=C(C)[C@H](O)[C@H](C)CSc1ccccc1 |
| InChI | InChI=1S/C13H18OS/c1-10(2)13(14)11(3)9-15-12-7-5-4-6-8-12/h4-8,11,13-14H,1,9H2,2-3H3/t11-,13+/m1/s1 |
| InChIKey | JUOUQJJWIOENCZ-YPMHNXCESA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol?
The IUPAC name of (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol (CID 101089327) is (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol.
What is the SMILES notation for (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol?
The canonical SMILES for (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol is C=C(C)[C@H](O)[C@H](C)CSc1ccccc1.
What is the InChIKey of (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol?
The InChIKey is JUOUQJJWIOENCZ-YPMHNXCESA-N. The full InChI is InChI=1S/C13H18OS/c1-10(2)13(14)11(3)9-15-12-7-5-4-6-8-12/h4-8,11,13-14H,1,9H2,2-3H3/t11-,13+/m1/s1.
What are the key properties of (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol?
(3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol has a molecular weight of 222.35 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol is sourced from PubChem (CID 101089327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).