C13H18OS — CID 101089327
(3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol (PubChem CID 101089327) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol.
| Compound Name | (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol |
|---|---|
| PubChem CID | 101089327 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-5-phenylsulfanylpent-1-en-3-ol |
| SMILES | C=C(C)[C@H](O)[C@H](C)CSc1ccccc1 |
| InChI | InChI=1S/C13H18OS/c1-10(2)13(14)11(3)9-15-12-7-5-4-6-8-12/h4-8,11,13-14H,1,9H2,2-3H3/t11-,13+/m1/s1 |
| InChIKey | JUOUQJJWIOENCZ-YPMHNXCESA-N |
| XLogP | 3.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|