C13H19NO2S — CID 22841174
(2S,3R)-3-hydroxy-4-methyl-2-(methylamino)-5-phenylsulfanylpentanal (PubChem CID 22841174) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-4-methyl-2-(methylamino)-5-phenylsulfanylpentanal.
| Compound Name | (2S,3R)-3-hydroxy-4-methyl-2-(methylamino)-5-phenylsulfanylpentanal |
|---|---|
| PubChem CID | 22841174 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S,3R)-3-hydroxy-4-methyl-2-(methylamino)-5-phenylsulfanylpentanal |
| SMILES | CN[C@H](C=O)[C@H](O)C(C)CSc1ccccc1 |
| InChI | InChI=1S/C13H19NO2S/c1-10(13(16)12(8-15)14-2)9-17-11-6-4-3-5-7-11/h3-8,10,12-14,16H,9H2,1-2H3/t10?,12-,13-/m1/s1 |
| InChIKey | ZVZRVIPUIDNJLZ-SKVSWLLESA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|