C12H23N3S — CID 66723752
N-methylmethanamine;4-phenylsulfanylbutane-1,3-diamine (PubChem CID 66723752) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is N-methylmethanamine;4-phenylsulfanylbutane-1,3-diamine.
| Compound Name | N-methylmethanamine;4-phenylsulfanylbutane-1,3-diamine |
|---|---|
| PubChem CID | 66723752 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-methylmethanamine;4-phenylsulfanylbutane-1,3-diamine |
| SMILES | CNC.NCCC(N)CSc1ccccc1 |
| InChI | InChI=1S/C10H16N2S.C2H7N/c11-7-6-9(12)8-13-10-4-2-1-3-5-10;1-3-2/h1-5,9H,6-8,11-12H2;3H,1-2H3 |
| InChIKey | BAQBZCUKKQQVAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |