C12H19FN2S — CID 87257708
(3R)-1-N-(2-fluoroethyl)-4-phenylsulfanylbutane-1,3-diamine (PubChem CID 87257708) has the molecular formula C12H19FN2S and a molecular weight of 242.36 g/mol. Its IUPAC name is (3R)-1-N-(2-fluoroethyl)-4-phenylsulfanylbutane-1,3-diamine.
| Compound Name | (3R)-1-N-(2-fluoroethyl)-4-phenylsulfanylbutane-1,3-diamine |
|---|---|
| PubChem CID | 87257708 |
| Molecular Formula | C12H19FN2S |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3R)-1-N-(2-fluoroethyl)-4-phenylsulfanylbutane-1,3-diamine |
| SMILES | N[C@H](CCNCCF)CSc1ccccc1 |
| InChI | InChI=1S/C12H19FN2S/c13-7-9-15-8-6-11(14)10-16-12-4-2-1-3-5-12/h1-5,11,15H,6-10,14H2/t11-/m1/s1 |
| InChIKey | FDFQDYCXZQDEIW-LLVKDONJSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|